C12H20F3NS — CID 106427251
N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine (PubChem CID 106427251) has the molecular formula C12H20F3NS and a molecular weight of 267.36 g/mol. Its IUPAC name is N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine.
| Compound Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106427251 |
| Molecular Formula | C12H20F3NS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
| SMILES | CC1=CC(C)CC(CNCCSC(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NS/c1-9-5-10(2)7-11(6-9)8-16-3-4-17-12(13,14)15/h5,9,11,16H,3-4,6-8H2,1-2H3 |
| InChIKey | GKHLUDGHWXLNDS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|