C13H23NS — CID 103277783
2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methyl-1,3-thiazinane (PubChem CID 103277783) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methyl-1,3-thiazinane.
| Compound Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methyl-1,3-thiazinane |
|---|---|
| PubChem CID | 103277783 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-6-methyl-1,3-thiazinane |
| SMILES | CC1=CC(C)CC(C2NCCC(C)S2)C1 |
| InChI | InChI=1S/C13H23NS/c1-9-6-10(2)8-12(7-9)13-14-5-4-11(3)15-13/h6,9,11-14H,4-5,7-8H2,1-3H3 |
| InChIKey | GUBWVOGXHSUSSS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|