C12H21NS — CID 103277780
2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazinane (PubChem CID 103277780) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazinane.
| Compound Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazinane |
|---|---|
| PubChem CID | 103277780 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 2-(3,5-dimethylcyclohex-3-en-1-yl)-1,3-thiazinane |
| SMILES | CC1=CC(C)CC(C2NCCCS2)C1 |
| InChI | InChI=1S/C12H21NS/c1-9-6-10(2)8-11(7-9)12-13-4-3-5-14-12/h6,9,11-13H,3-5,7-8H2,1-2H3 |
| InChIKey | ZTNREFOMLFHIJA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|