C7H13N3 — CID 103281677
2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine (PubChem CID 103281677) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine.
| Compound Name | 2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 103281677 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 2-methyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine |
| SMILES | CC1CN2CCCN=C2N1 |
| InChI | InChI=1S/C7H13N3/c1-6-5-10-4-2-3-8-7(10)9-6/h6H,2-5H2,1H3,(H,8,9) |
| InChIKey | HHYYHYPIGDVZIG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |