C13H15F5N2 — CID 115564862
4-methyl-1-(2,3,4,5,6-pentafluorophenyl)-1,5-diazocane (PubChem CID 115564862) has the molecular formula C13H15F5N2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-methyl-1-(2,3,4,5,6-pentafluorophenyl)-1,5-diazocane.
| Compound Name | 4-methyl-1-(2,3,4,5,6-pentafluorophenyl)-1,5-diazocane |
|---|---|
| PubChem CID | 115564862 |
| Molecular Formula | C13H15F5N2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-methyl-1-(2,3,4,5,6-pentafluorophenyl)-1,5-diazocane |
| SMILES | CC1CCN(c2c(F)c(F)c(F)c(F)c2F)CCCN1 |
| InChI | InChI=1S/C13H15F5N2/c1-7-3-6-20(5-2-4-19-7)13-11(17)9(15)8(14)10(16)12(13)18/h7,19H,2-6H2,1H3 |
| InChIKey | ISURBSZLHRNNIO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|