C13H17ClFN3 — CID 103295597
N-(4-chloro-2-ethylbutyl)-6-fluoro-1H-benzimidazol-2-amine (PubChem CID 103295597) has the molecular formula C13H17ClFN3 and a molecular weight of 269.75 g/mol. Its IUPAC name is N-(4-chloro-2-ethylbutyl)-6-fluoro-1H-benzimidazol-2-amine.
| Compound Name | N-(4-chloro-2-ethylbutyl)-6-fluoro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 103295597 |
| Molecular Formula | C13H17ClFN3 |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-(4-chloro-2-ethylbutyl)-6-fluoro-1H-benzimidazol-2-amine |
| SMILES | CCC(CCCl)CNc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C13H17ClFN3/c1-2-9(5-6-14)8-16-13-17-11-4-3-10(15)7-12(11)18-13/h3-4,7,9H,2,5-6,8H2,1H3,(H2,16,17,18) |
| InChIKey | KEHGWUHBCLNOIL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|