C14H19ClFN3 — CID 107156214
N-(2-chloro-4,4-dimethylpentyl)-6-fluoro-1H-benzimidazol-2-amine (PubChem CID 107156214) has the molecular formula C14H19ClFN3 and a molecular weight of 283.78 g/mol. Its IUPAC name is N-(2-chloro-4,4-dimethylpentyl)-6-fluoro-1H-benzimidazol-2-amine.
| Compound Name | N-(2-chloro-4,4-dimethylpentyl)-6-fluoro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 107156214 |
| Molecular Formula | C14H19ClFN3 |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-(2-chloro-4,4-dimethylpentyl)-6-fluoro-1H-benzimidazol-2-amine |
| SMILES | CC(C)(C)CC(Cl)CNc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C14H19ClFN3/c1-14(2,3)7-9(15)8-17-13-18-11-5-4-10(16)6-12(11)19-13/h4-6,9H,7-8H2,1-3H3,(H2,17,18,19) |
| InChIKey | QPAWGZQSYRPWBQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|