C12H14Cl2FN3 — CID 114010827
N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-fluoro-1H-benzimidazol-2-amine (PubChem CID 114010827) has the molecular formula C12H14Cl2FN3 and a molecular weight of 290.17 g/mol. Its IUPAC name is N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-fluoro-1H-benzimidazol-2-amine.
| Compound Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-fluoro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 114010827 |
| Molecular Formula | C12H14Cl2FN3 |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-[1-chloro-2-(chloromethyl)butan-2-yl]-6-fluoro-1H-benzimidazol-2-amine |
| SMILES | CCC(CCl)(CCl)Nc1nc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C12H14Cl2FN3/c1-2-12(6-13,7-14)18-11-16-9-4-3-8(15)5-10(9)17-11/h3-5H,2,6-7H2,1H3,(H2,16,17,18) |
| InChIKey | GCHWFDGBLRTJLK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|