C11H16FN3O3S — CID 103302658
1-[4-[(3-fluoro-2-pyridinyl)sulfonyl]morpholin-2-yl]ethanamine (PubChem CID 103302658) has the molecular formula C11H16FN3O3S and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-[4-[(3-fluoro-2-pyridinyl)sulfonyl]morpholin-2-yl]ethanamine.
| Compound Name | 1-[4-[(3-fluoro-2-pyridinyl)sulfonyl]morpholin-2-yl]ethanamine |
|---|---|
| PubChem CID | 103302658 |
| Molecular Formula | C11H16FN3O3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1-[4-[(3-fluoro-2-pyridinyl)sulfonyl]morpholin-2-yl]ethanamine |
| SMILES | CC(N)C1CN(S(=O)(=O)c2ncccc2F)CCO1 |
| InChI | InChI=1S/C11H16FN3O3S/c1-8(13)10-7-15(5-6-18-10)19(16,17)11-9(12)3-2-4-14-11/h2-4,8,10H,5-7,13H2,1H3 |
| InChIKey | RDFOEJBWIYSXMK-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |