C10H15BrN4O — CID 103340783
6-bromo-2-N-(2-methoxyethyl)-2-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 103340783) has the molecular formula C10H15BrN4O and a molecular weight of 287.16 g/mol. Its IUPAC name is 6-bromo-2-N-(2-methoxyethyl)-2-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 6-bromo-2-N-(2-methoxyethyl)-2-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 103340783 |
| Molecular Formula | C10H15BrN4O |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 6-bromo-2-N-(2-methoxyethyl)-2-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCN(CCOC)c1nc(N)cc(Br)n1 |
| InChI | InChI=1S/C10H15BrN4O/c1-3-4-15(5-6-16-2)10-13-8(11)7-9(12)14-10/h3,7H,1,4-6H2,2H3,(H2,12,13,14) |
| InChIKey | HOLPFHVQUIGXQM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|