About Te-butyl naphthalene-2-carbotelluroate
Te-butyl naphthalene-2-carbotelluroate (PubChem CID 10337284) has the molecular formula C15H16OTe
and a molecular weight of 339.89 g/mol. Its IUPAC name is Te-butyl naphthalene-2-carbotelluroate.
Molecular Properties
| Compound Name | Te-butyl naphthalene-2-carbotelluroate |
| PubChem CID | 10337284 |
| Molecular Formula | C15H16OTe |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | Te-butyl naphthalene-2-carbotelluroate |
| SMILES | CCCC[Te]C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H16OTe/c1-2-3-10-17-15(16)14-9-8-12-6-4-5-7-13(12)11-14/h4-9,11H,2-3,10H2,1H3 |
| InChIKey | ISKJYNHOSUTECA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Te-butyl naphthalene-2-carbotelluroate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Te-butyl naphthalene-2-carbotelluroate?
The IUPAC name of Te-butyl naphthalene-2-carbotelluroate (CID 10337284) is Te-butyl naphthalene-2-carbotelluroate.
What is the SMILES notation for Te-butyl naphthalene-2-carbotelluroate?
The canonical SMILES for Te-butyl naphthalene-2-carbotelluroate is CCCC[Te]C(=O)c1ccc2ccccc2c1.
What is the InChIKey of Te-butyl naphthalene-2-carbotelluroate?
The InChIKey is ISKJYNHOSUTECA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16OTe/c1-2-3-10-17-15(16)14-9-8-12-6-4-5-7-13(12)11-14/h4-9,11H,2-3,10H2,1H3.
What are the key properties of Te-butyl naphthalene-2-carbotelluroate?
Te-butyl naphthalene-2-carbotelluroate has a molecular weight of 339.89 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Te-butyl naphthalene-2-carbotelluroate is sourced from PubChem (CID 10337284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).