C19H26N4O2 — CID 10337449
4-azido-1-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)piperidine (PubChem CID 10337449) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-azido-1-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)piperidine.
| Compound Name | 4-azido-1-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)piperidine |
|---|---|
| PubChem CID | 10337449 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 4-azido-1-(8-phenyl-1,4-dioxaspiro[4.5]decan-8-yl)piperidine |
| SMILES | [N-]=[N+]=NC1CCN(C2(c3ccccc3)CCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C19H26N4O2/c20-22-21-17-6-12-23(13-7-17)18(16-4-2-1-3-5-16)8-10-19(11-9-18)24-14-15-25-19/h1-5,17H,6-15H2 |
| InChIKey | VDOVHHWEIQIZND-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|