C18H17N3O2 — CID 139185418
[(2R,3S)-3-azido-2-phenyloxan-2-yl]-phenylmethanone (PubChem CID 139185418) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is [(2R,3S)-3-azido-2-phenyloxan-2-yl]-phenylmethanone.
| Compound Name | [(2R,3S)-3-azido-2-phenyloxan-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139185418 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | [(2R,3S)-3-azido-2-phenyloxan-2-yl]-phenylmethanone |
| SMILES | [N-]=[N+]=N[C@H]1CCCO[C@]1(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c19-21-20-16-12-7-13-23-18(16,15-10-5-2-6-11-15)17(22)14-8-3-1-4-9-14/h1-6,8-11,16H,7,12-13H2/t16-,18+/m0/s1 |
| InChIKey | DKXVCAINFJAVQQ-FUHWJXTLSA-N |
| XLogP | 4.25 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|