C22H21N3O6 — CID 123325735
[(2S,3S,4R,5R)-5-azido-3-benzoyl-2,3,4-trihydroxy-2-prop-2-enyloxan-4-yl]-phenylmethanone (PubChem CID 123325735) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-azido-3-benzoyl-2,3,4-trihydroxy-2-prop-2-enyloxan-4-yl]-phenylmethanone.
| Compound Name | [(2S,3S,4R,5R)-5-azido-3-benzoyl-2,3,4-trihydroxy-2-prop-2-enyloxan-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 123325735 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [(2S,3S,4R,5R)-5-azido-3-benzoyl-2,3,4-trihydroxy-2-prop-2-enyloxan-4-yl]-phenylmethanone |
| SMILES | C=CC[C@]1(O)OC[C@@H](N=[N+]=[N-])[C@](O)(C(=O)c2ccccc2)[C@]1(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21N3O6/c1-2-13-20(28)22(30,19(27)16-11-7-4-8-12-16)21(29,17(14-31-20)24-25-23)18(26)15-9-5-3-6-10-15/h2-12,17,28-30H,1,13-14H2/t17-,20+,21+,22+/m1/s1 |
| InChIKey | BJFNSQDHVGTGTD-MNAPGUCWSA-N |
| XLogP | 2.19 |
| TPSA | 152.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|