C22H21N3O6 — CID 123661373
[(3S,4S,5S)-5-azido-3-benzoyloxy-2-hydroxy-2-prop-2-enyloxan-4-yl] benzoate (PubChem CID 123661373) has the molecular formula C22H21N3O6 and a molecular weight of 423.43 g/mol. Its IUPAC name is [(3S,4S,5S)-5-azido-3-benzoyloxy-2-hydroxy-2-prop-2-enyloxan-4-yl] benzoate.
| Compound Name | [(3S,4S,5S)-5-azido-3-benzoyloxy-2-hydroxy-2-prop-2-enyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 123661373 |
| Molecular Formula | C22H21N3O6 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [(3S,4S,5S)-5-azido-3-benzoyloxy-2-hydroxy-2-prop-2-enyloxan-4-yl] benzoate |
| SMILES | C=CCC1(O)OC[C@H](N=[N+]=[N-])[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H21N3O6/c1-2-13-22(28)19(31-21(27)16-11-7-4-8-12-16)18(17(14-29-22)24-25-23)30-20(26)15-9-5-3-6-10-15/h2-12,17-19,28H,1,13-14H2/t17-,18-,19-,22?/m0/s1 |
| InChIKey | WZCXMKMPJQQOAL-KDLWQYFGSA-N |
| XLogP | 3.41 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|