C13H19NO2 — CID 103377388
3-[[1-(aminomethyl)-2,3-dihydroinden-1-yl]oxy]propan-1-ol (PubChem CID 103377388) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-[[1-(aminomethyl)-2,3-dihydroinden-1-yl]oxy]propan-1-ol.
| Compound Name | 3-[[1-(aminomethyl)-2,3-dihydroinden-1-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 103377388 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 3-[[1-(aminomethyl)-2,3-dihydroinden-1-yl]oxy]propan-1-ol |
| SMILES | NCC1(OCCCO)CCc2ccccc21 |
| InChI | InChI=1S/C13H19NO2/c14-10-13(16-9-3-8-15)7-6-11-4-1-2-5-12(11)13/h1-2,4-5,15H,3,6-10,14H2 |
| InChIKey | BBPSBSIJBCHYNA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|