C15H22O4S — CID 139958004
1-pentoxy-3,4-dihydro-2H-naphthalene-1-sulfonic acid (PubChem CID 139958004) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is 1-pentoxy-3,4-dihydro-2H-naphthalene-1-sulfonic acid.
| Compound Name | 1-pentoxy-3,4-dihydro-2H-naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 139958004 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 1-pentoxy-3,4-dihydro-2H-naphthalene-1-sulfonic acid |
| SMILES | CCCCCOC1(S(=O)(=O)O)CCCc2ccccc21 |
| InChI | InChI=1S/C15H22O4S/c1-2-3-6-12-19-15(20(16,17)18)11-7-9-13-8-4-5-10-14(13)15/h4-5,8,10H,2-3,6-7,9,11-12H2,1H3,(H,16,17,18) |
| InChIKey | BLVPMLQAMJHOHA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|