C26H22N2O3 — CID 1034128
[1-[(Z)-(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]naphthalen-2-yl] benzoate (PubChem CID 1034128) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is [1-[(Z)-(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]naphthalen-2-yl] benzoate.
| Compound Name | [1-[(Z)-(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]naphthalen-2-yl] benzoate |
|---|---|
| PubChem CID | 1034128 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [1-[(Z)-(3-oxo-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-2-ylidene)methyl]naphthalen-2-yl] benzoate |
| SMILES | O=C(Oc1ccc2ccccc2c1/C=C1\N=C2CCCCCN2C1=O)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O3/c29-25-22(27-24-13-5-2-8-16-28(24)25)17-21-20-12-7-6-9-18(20)14-15-23(21)31-26(30)19-10-3-1-4-11-19/h1,3-4,6-7,9-12,14-15,17H,2,5,8,13,16H2/b22-17- |
| InChIKey | QWVOPXLLRDJFJH-XLNRJJMWSA-N |
| XLogP | 5.21 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|