C11H13N3O2S2 — CID 103413922
N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 103413922) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103413922 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(C)c2ccccc2N)s1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-8-13-7-11(17-8)18(15,16)14(2)10-6-4-3-5-9(10)12/h3-7H,12H2,1-2H3 |
| InChIKey | PBGZCYJXUMKTIS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|