About N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide
N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 103413922) has the molecular formula C11H13N3O2S2
and a molecular weight of 283.38 g/mol. Its IUPAC name is N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 103413922 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(C)c2ccccc2N)s1 |
| InChI | InChI=1S/C11H13N3O2S2/c1-8-13-7-11(17-8)18(15,16)14(2)10-6-4-3-5-9(10)12/h3-7H,12H2,1-2H3 |
| InChIKey | PBGZCYJXUMKTIS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide (CID 103413922) is N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide is Cc1ncc(S(=O)(=O)N(C)c2ccccc2N)s1.
What is the InChIKey of N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The InChIKey is PBGZCYJXUMKTIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S2/c1-8-13-7-11(17-8)18(15,16)14(2)10-6-4-3-5-9(10)12/h3-7H,12H2,1-2H3.
What are the key properties of N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide has a molecular weight of 283.38 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-N,2-dimethyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 103413922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).