C17H22N4O8S — CID 10343288
methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-(1-phenyltetrazol-5-yl)sulfanyl-6-[(1S,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 10343288) has the molecular formula C17H22N4O8S and a molecular weight of 442.45 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-(1-phenyltetrazol-5-yl)sulfanyl-6-[(1S,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-(1-phenyltetrazol-5-yl)sulfanyl-6-[(1S,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10343288 |
| Molecular Formula | C17H22N4O8S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4,5-dihydroxy-2-(1-phenyltetrazol-5-yl)sulfanyl-6-[(1S,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2nnnn2-c2ccccc2)C[C@H](O)[C@@H](O)[C@H]([C@@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C17H22N4O8S/c1-28-15(27)17(7-10(23)12(25)14(29-17)13(26)11(24)8-22)30-16-18-19-20-21(16)9-5-3-2-4-6-9/h2-6,10-14,22-26H,7-8H2,1H3/t10-,11+,12+,13-,14+,17+/m0/s1 |
| InChIKey | PQGGSWMNNLKRPU-UMIRMJGQSA-N |
| XLogP | -2.15 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |