C31H30N2O3 — CID 10345009
17'-(diethylamino)-9'-ethylspiro[2-benzofuran-3,13'-20-oxa-9-azapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,4(8),10,14(19),15,17-heptaene]-1-one (PubChem CID 10345009) has the molecular formula C31H30N2O3 and a molecular weight of 478.59 g/mol. Its IUPAC name is 17'-(diethylamino)-9'-ethylspiro[2-benzofuran-3,13'-20-oxa-9-azapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,4(8),10,14(19),15,17-heptaene]-1-one.
| Compound Name | 17'-(diethylamino)-9'-ethylspiro[2-benzofuran-3,13'-20-oxa-9-azapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,4(8),10,14(19),15,17-heptaene]-1-one |
|---|---|
| PubChem CID | 10345009 |
| Molecular Formula | C31H30N2O3 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 17'-(diethylamino)-9'-ethylspiro[2-benzofuran-3,13'-20-oxa-9-azapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1(12),2,4(8),10,14(19),15,17-heptaene]-1-one |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc3c4c(n(CC)c3cc1C21OC(=O)c2ccccc21)CCC4 |
| InChI | InChI=1S/C31H30N2O3/c1-4-32(5-2)19-14-15-24-28(16-19)35-29-17-22-20-11-9-13-26(20)33(6-3)27(22)18-25(29)31(24)23-12-8-7-10-21(23)30(34)36-31/h7-8,10,12,14-18H,4-6,9,11,13H2,1-3H3 |
| InChIKey | TVFZSDQEKIEVTK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|