C31H56O5Si — CID 10347126
ethyl (E)-10-(methoxymethoxy)-6,10-dimethyl-3-prop-1-en-2-yl-13-tri(propan-2-yl)silyloxytridec-6-en-11-ynoate (PubChem CID 10347126) has the molecular formula C31H56O5Si and a molecular weight of 536.87 g/mol. Its IUPAC name is ethyl (E)-10-(methoxymethoxy)-6,10-dimethyl-3-prop-1-en-2-yl-13-tri(propan-2-yl)silyloxytridec-6-en-11-ynoate.
| Compound Name | ethyl (E)-10-(methoxymethoxy)-6,10-dimethyl-3-prop-1-en-2-yl-13-tri(propan-2-yl)silyloxytridec-6-en-11-ynoate |
|---|---|
| PubChem CID | 10347126 |
| Molecular Formula | C31H56O5Si |
| Molecular Weight | 536.87 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | ethyl (E)-10-(methoxymethoxy)-6,10-dimethyl-3-prop-1-en-2-yl-13-tri(propan-2-yl)silyloxytridec-6-en-11-ynoate |
| SMILES | C=C(C)C(CC/C(C)=C/CCC(C)(C#CCO[Si](C(C)C)(C(C)C)C(C)C)OCOC)CC(=O)OCC |
| InChI | InChI=1S/C31H56O5Si/c1-13-34-30(32)22-29(24(2)3)18-17-28(10)16-14-19-31(11,35-23-33-12)20-15-21-36-37(25(4)5,26(6)7)27(8)9/h16,25-27,29H,2,13-14,17-19,21-23H2,1,3-12H3/b28-16+ |
| InChIKey | QFOQDHRPVPCPJD-LQKURTRISA-N |
| XLogP | 8.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.87 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|