C23H44O5Si — CID 44556575
[(2E,6R,7S)-7-(methoxymethoxy)-3,7-dimethyl-6-triethylsilyloxyundeca-2,10-dienyl] acetate (PubChem CID 44556575) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is [(2E,6R,7S)-7-(methoxymethoxy)-3,7-dimethyl-6-triethylsilyloxyundeca-2,10-dienyl] acetate.
| Compound Name | [(2E,6R,7S)-7-(methoxymethoxy)-3,7-dimethyl-6-triethylsilyloxyundeca-2,10-dienyl] acetate |
|---|---|
| PubChem CID | 44556575 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | [(2E,6R,7S)-7-(methoxymethoxy)-3,7-dimethyl-6-triethylsilyloxyundeca-2,10-dienyl] acetate |
| SMILES | C=CCC[C@](C)(OCOC)[C@@H](CC/C(C)=C/COC(C)=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H44O5Si/c1-9-13-17-23(7,27-19-25-8)22(28-29(10-2,11-3)12-4)15-14-20(5)16-18-26-21(6)24/h9,16,22H,1,10-15,17-19H2,2-8H3/b20-16+/t22-,23+/m1/s1 |
| InChIKey | NRPFLGJQGOADNA-AUAXGQTGSA-N |
| XLogP | 6.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|