C24H46O3Si — CID 101169637
[(2E)-3,7-dimethylocta-2,6-dienyl] (3S)-3-methyl-4-tri(propan-2-yl)silyloxybutanoate (PubChem CID 101169637) has the molecular formula C24H46O3Si and a molecular weight of 410.72 g/mol. Its IUPAC name is [(2E)-3,7-dimethylocta-2,6-dienyl] (3S)-3-methyl-4-tri(propan-2-yl)silyloxybutanoate.
| Compound Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (3S)-3-methyl-4-tri(propan-2-yl)silyloxybutanoate |
|---|---|
| PubChem CID | 101169637 |
| Molecular Formula | C24H46O3Si |
| Molecular Weight | 410.72 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | [(2E)-3,7-dimethylocta-2,6-dienyl] (3S)-3-methyl-4-tri(propan-2-yl)silyloxybutanoate |
| SMILES | CC(C)=CCC/C(C)=C/COC(=O)C[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H46O3Si/c1-18(2)12-11-13-22(9)14-15-26-24(25)16-23(10)17-27-28(19(3)4,20(5)6)21(7)8/h12,14,19-21,23H,11,13,15-17H2,1-10H3/b22-14+/t23-/m0/s1 |
| InChIKey | KNPWAUJUKSIAKK-DZSAKIAFSA-N |
| XLogP | 7.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.72 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|