C23H33F5N4O5S — CID 10348059
N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide (PubChem CID 10348059) has the molecular formula C23H33F5N4O5S and a molecular weight of 572.60 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10348059 |
| Molecular Formula | C23H33F5N4O5S |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)C(F)(F)F)cn3)CC2)CC1 |
| InChI | InChI=1S/C23H33F5N4O5S/c1-37-15-14-31-12-8-21(9-13-31,20(33)30-34)38(35,36)32-10-5-18(6-11-32)19-3-2-17(16-29-19)4-7-22(24,25)23(26,27)28/h2-3,16,18,34H,4-15H2,1H3,(H,30,33) |
| InChIKey | LXJSEUPSKPADMD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|