C39H38N6O6 — CID 10350173
dibenzyl 2-[2-[[2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetyl]amino]acetyl]pentanedioate (PubChem CID 10350173) has the molecular formula C39H38N6O6 and a molecular weight of 686.77 g/mol. Its IUPAC name is dibenzyl 2-[2-[[2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetyl]amino]acetyl]pentanedioate.
| Compound Name | dibenzyl 2-[2-[[2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetyl]amino]acetyl]pentanedioate |
|---|---|
| PubChem CID | 10350173 |
| Molecular Formula | C39H38N6O6 |
| Molecular Weight | 686.77 g/mol |
| Exact Mass | 686.29 |
| IUPAC Name | dibenzyl 2-[2-[[2-[6-carbamimidoyl-2-(4-carbamimidoylphenyl)-1H-indol-3-yl]acetyl]amino]acetyl]pentanedioate |
| SMILES | [H]/N=C(\N)c1ccc(-c2[nH]c3cc(/C(N)=N/[H])ccc3c2CC(=O)NCC(=O)C(CCC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C39H38N6O6/c40-37(41)27-13-11-26(12-14-27)36-31(29-16-15-28(38(42)43)19-32(29)45-36)20-34(47)44-21-33(46)30(39(49)51-23-25-9-5-2-6-10-25)17-18-35(48)50-22-24-7-3-1-4-8-24/h1-16,19,30,45H,17-18,20-23H2,(H3,40,41)(H3,42,43)(H,44,47) |
| InChIKey | IZWXIVONIWAASY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 214.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|