C9H12F2N2OS — CID 103515686
N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide (PubChem CID 103515686) has the molecular formula C9H12F2N2OS and a molecular weight of 234.27 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103515686 |
| Molecular Formula | C9H12F2N2OS |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2,2-difluoroacetamide |
| SMILES | CC(C)(C)c1csc(NC(=O)C(F)F)n1 |
| InChI | InChI=1S/C9H12F2N2OS/c1-9(2,3)5-4-15-8(12-5)13-7(14)6(10)11/h4,6H,1-3H3,(H,12,13,14) |
| InChIKey | PWUWTBUWWIIAPJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |