C9H14ClF2NO3 — CID 103516338
N-(1-chloro-6-methoxy-2-oxohexan-3-yl)-2,2-difluoroacetamide (PubChem CID 103516338) has the molecular formula C9H14ClF2NO3 and a molecular weight of 257.66 g/mol. Its IUPAC name is N-(1-chloro-6-methoxy-2-oxohexan-3-yl)-2,2-difluoroacetamide.
| Compound Name | N-(1-chloro-6-methoxy-2-oxohexan-3-yl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103516338 |
| Molecular Formula | C9H14ClF2NO3 |
| Molecular Weight | 257.66 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | N-(1-chloro-6-methoxy-2-oxohexan-3-yl)-2,2-difluoroacetamide |
| SMILES | COCCCC(NC(=O)C(F)F)C(=O)CCl |
| InChI | InChI=1S/C9H14ClF2NO3/c1-16-4-2-3-6(7(14)5-10)13-9(15)8(11)12/h6,8H,2-5H2,1H3,(H,13,15) |
| InChIKey | NUVJICMJDQOKLN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|