C7H9ClF3NO3 — CID 104701689
N-(4-chloro-1-methoxy-3-oxobutan-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 104701689) has the molecular formula C7H9ClF3NO3 and a molecular weight of 247.60 g/mol. Its IUPAC name is N-(4-chloro-1-methoxy-3-oxobutan-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-chloro-1-methoxy-3-oxobutan-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104701689 |
| Molecular Formula | C7H9ClF3NO3 |
| Molecular Weight | 247.60 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | N-(4-chloro-1-methoxy-3-oxobutan-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | COCC(NC(=O)C(F)(F)F)C(=O)CCl |
| InChI | InChI=1S/C7H9ClF3NO3/c1-15-3-4(5(13)2-8)12-6(14)7(9,10)11/h4H,2-3H2,1H3,(H,12,14) |
| InChIKey | JKDMHVXIIUXHDN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.60 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|