C8H12F2N4O2 — CID 103517318
[1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 103517318) has the molecular formula C8H12F2N4O2 and a molecular weight of 234.21 g/mol. Its IUPAC name is [1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 103517318 |
| Molecular Formula | C8H12F2N4O2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | [1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | COc1cnc(C(NN)C(F)F)c(OC)n1 |
| InChI | InChI=1S/C8H12F2N4O2/c1-15-4-3-12-6(8(13-4)16-2)5(14-11)7(9)10/h3,5,7,14H,11H2,1-2H3 |
| InChIKey | VRFCLMYKXFRRSL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|