About but-3-enyl 2-(2-oxoethenyl)benzoate
but-3-enyl 2-(2-oxoethenyl)benzoate (PubChem CID 10353258) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is but-3-enyl 2-(2-oxoethenyl)benzoate.
Molecular Properties
| Compound Name | but-3-enyl 2-(2-oxoethenyl)benzoate |
| PubChem CID | 10353258 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | but-3-enyl 2-(2-oxoethenyl)benzoate |
| SMILES | C=CCCOC(=O)c1ccccc1C=C=O |
| InChI | InChI=1S/C13H12O3/c1-2-3-10-16-13(15)12-7-5-4-6-11(12)8-9-14/h2,4-8H,1,3,10H2 |
| InChIKey | WMUMVXDQGBVHRM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 2-(2-oxoethenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 2-(2-oxoethenyl)benzoate?
The IUPAC name of but-3-enyl 2-(2-oxoethenyl)benzoate (CID 10353258) is but-3-enyl 2-(2-oxoethenyl)benzoate.
What is the SMILES notation for but-3-enyl 2-(2-oxoethenyl)benzoate?
The canonical SMILES for but-3-enyl 2-(2-oxoethenyl)benzoate is C=CCCOC(=O)c1ccccc1C=C=O.
What is the InChIKey of but-3-enyl 2-(2-oxoethenyl)benzoate?
The InChIKey is WMUMVXDQGBVHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O3/c1-2-3-10-16-13(15)12-7-5-4-6-11(12)8-9-14/h2,4-8H,1,3,10H2.
What are the key properties of but-3-enyl 2-(2-oxoethenyl)benzoate?
but-3-enyl 2-(2-oxoethenyl)benzoate has a molecular weight of 216.24 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 2-(2-oxoethenyl)benzoate is sourced from PubChem (CID 10353258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).