C12H12O2 — CID 11252454
penta-3,4-dienyl benzoate (PubChem CID 11252454) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is penta-3,4-dienyl benzoate.
| Compound Name | penta-3,4-dienyl benzoate |
|---|---|
| PubChem CID | 11252454 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | penta-3,4-dienyl benzoate |
| SMILES | C=C=CCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-2-3-7-10-14-12(13)11-8-5-4-6-9-11/h3-6,8-9H,1,7,10H2 |
| InChIKey | ZSSFKCDDDUFLCP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|