C13H22O2Si — CID 10354210
(1S,4S)-4-methoxy-2,3,4-trimethyl-1-(2-trimethylsilylethynyl)cyclobut-2-en-1-ol (PubChem CID 10354210) has the molecular formula C13H22O2Si and a molecular weight of 238.40 g/mol. Its IUPAC name is (1S,4S)-4-methoxy-2,3,4-trimethyl-1-(2-trimethylsilylethynyl)cyclobut-2-en-1-ol.
| Compound Name | (1S,4S)-4-methoxy-2,3,4-trimethyl-1-(2-trimethylsilylethynyl)cyclobut-2-en-1-ol |
|---|---|
| PubChem CID | 10354210 |
| Molecular Formula | C13H22O2Si |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | (1S,4S)-4-methoxy-2,3,4-trimethyl-1-(2-trimethylsilylethynyl)cyclobut-2-en-1-ol |
| SMILES | CO[C@@]1(C)C(C)=C(C)[C@]1(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H22O2Si/c1-10-11(2)13(14,12(10,3)15-4)8-9-16(5,6)7/h14H,1-7H3/t12-,13+/m0/s1 |
| InChIKey | KYEORRMXGDKUIB-QWHCGFSZSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|