C9H18O5S — CID 103547389
1-(1,3-dioxolan-2-yl)-5-methylsulfonylpentan-2-ol (PubChem CID 103547389) has the molecular formula C9H18O5S and a molecular weight of 238.30 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-5-methylsulfonylpentan-2-ol.
| Compound Name | 1-(1,3-dioxolan-2-yl)-5-methylsulfonylpentan-2-ol |
|---|---|
| PubChem CID | 103547389 |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-5-methylsulfonylpentan-2-ol |
| SMILES | CS(=O)(=O)CCCC(O)CC1OCCO1 |
| InChI | InChI=1S/C9H18O5S/c1-15(11,12)6-2-3-8(10)7-9-13-4-5-14-9/h8-10H,2-7H2,1H3 |
| InChIKey | WFZVTDOAEKJKLV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |