About 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one
6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one (PubChem CID 10354947) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one.
Molecular Properties
| Compound Name | 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one |
| PubChem CID | 10354947 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one |
| SMILES | CCCCCc1oc([C@H](O)CO)c2c1C(=O)OC2 |
| InChI | InChI=1S/C13H18O5/c1-2-3-4-5-10-11-8(7-17-13(11)16)12(18-10)9(15)6-14/h9,14-15H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | WBFLTSXAHCDLOK-SECBINFHSA-N |
| XLogP | 1.71 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one?
The IUPAC name of 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one (CID 10354947) is 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one.
What is the SMILES notation for 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one?
The canonical SMILES for 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one is CCCCCc1oc([C@H](O)CO)c2c1C(=O)OC2.
What is the InChIKey of 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one?
The InChIKey is WBFLTSXAHCDLOK-SECBINFHSA-N. The full InChI is InChI=1S/C13H18O5/c1-2-3-4-5-10-11-8(7-17-13(11)16)12(18-10)9(15)6-14/h9,14-15H,2-7H2,1H3/t9-/m1/s1.
What are the key properties of 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one?
6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one has a molecular weight of 254.28 g/mol, XLogP of 1.71, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one is sourced from PubChem (CID 10354947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).