C13H18O5 — CID 10354947
6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one (PubChem CID 10354947) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one.
| Compound Name | 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one |
|---|---|
| PubChem CID | 10354947 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 6-[(1R)-1,2-dihydroxyethyl]-4-pentyl-1H-furo[3,4-c]furan-3-one |
| SMILES | CCCCCc1oc([C@H](O)CO)c2c1C(=O)OC2 |
| InChI | InChI=1S/C13H18O5/c1-2-3-4-5-10-11-8(7-17-13(11)16)12(18-10)9(15)6-14/h9,14-15H,2-7H2,1H3/t9-/m1/s1 |
| InChIKey | WBFLTSXAHCDLOK-SECBINFHSA-N |
| XLogP | 1.71 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|