C15H25N3O4 — CID 103554264
tert-butyl 3-[1-hydroxy-2-(1-methylpyrazol-3-yl)ethyl]morpholine-4-carboxylate (PubChem CID 103554264) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is tert-butyl 3-[1-hydroxy-2-(1-methylpyrazol-3-yl)ethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[1-hydroxy-2-(1-methylpyrazol-3-yl)ethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 103554264 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | tert-butyl 3-[1-hydroxy-2-(1-methylpyrazol-3-yl)ethyl]morpholine-4-carboxylate |
| SMILES | Cn1ccc(CC(O)C2COCCN2C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C15H25N3O4/c1-15(2,3)22-14(20)18-7-8-21-10-12(18)13(19)9-11-5-6-17(4)16-11/h5-6,12-13,19H,7-10H2,1-4H3 |
| InChIKey | CBGIUXUVYXYDOJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |