C9H14N2OS — CID 103558694
4-[(1-methoxycyclobutyl)methyl]-1,3-thiazol-2-amine (PubChem CID 103558694) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-[(1-methoxycyclobutyl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[(1-methoxycyclobutyl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103558694 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-[(1-methoxycyclobutyl)methyl]-1,3-thiazol-2-amine |
| SMILES | COC1(Cc2csc(N)n2)CCC1 |
| InChI | InChI=1S/C9H14N2OS/c1-12-9(3-2-4-9)5-7-6-13-8(10)11-7/h6H,2-5H2,1H3,(H2,10,11) |
| InChIKey | MRGJSOKHWKMSKL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |