C5H9NaO6S2 — CID 103574113
sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate (PubChem CID 103574113) has the molecular formula C5H9NaO6S2 and a molecular weight of 252.24 g/mol. Its IUPAC name is sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate.
| Compound Name | sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate |
|---|---|
| PubChem CID | 103574113 |
| Molecular Formula | C5H9NaO6S2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate |
| SMILES | O=S1(=O)CCCC(O)(S(=O)(=O)[O-])C1.[Na+] |
| InChI | InChI=1S/C5H10O6S2.Na/c6-5(13(9,10)11)2-1-3-12(7,8)4-5;/h6H,1-4H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | MVNIOVZYDRKEHD-UHFFFAOYSA-M |
| XLogP | -4.57 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|