sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate

C5H9NaO6S2 — CID 103574113

IUPACsodium 3-hydroxy-1,1-dioxothiane-3-sulfonate
SMILESO=S1(=O)CCCC(O)(S(=O)(=O)[O-])C1.[Na+]
InChIInChI=1S/C5H10O6S2.Na/c6-5(13(9,10)11)2-1-3-12(7,8)4-5;/h6H,1-4H2,(H,9,10,11);/q;+1/p-1
InChIKeyMVNIOVZYDRKEHD-UHFFFAOYSA-M
MW252.24 g/mol
LogP-4.57
Rot. Bonds1

About sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate

sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate (PubChem CID 103574113) has the molecular formula C5H9NaO6S2 and a molecular weight of 252.24 g/mol. Its IUPAC name is sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate.

Molecular Properties

Compound Namesodium 3-hydroxy-1,1-dioxothiane-3-sulfonate
PubChem CID103574113
Molecular FormulaC5H9NaO6S2
Molecular Weight252.24 g/mol
Exact Mass251.97
IUPAC Namesodium 3-hydroxy-1,1-dioxothiane-3-sulfonate
SMILESO=S1(=O)CCCC(O)(S(=O)(=O)[O-])C1.[Na+]
InChIInChI=1S/C5H10O6S2.Na/c6-5(13(9,10)11)2-1-3-12(7,8)4-5;/h6H,1-4H2,(H,9,10,11);/q;+1/p-1
InChIKeyMVNIOVZYDRKEHD-UHFFFAOYSA-M
XLogP-4.57
TPSA111.57 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.24
LogP ≤ 5-4.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate?
The IUPAC name of sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate (CID 103574113) is sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate.
What is the SMILES notation for sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate?
The canonical SMILES for sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate is O=S1(=O)CCCC(O)(S(=O)(=O)[O-])C1.[Na+].
What is the InChIKey of sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate?
The InChIKey is MVNIOVZYDRKEHD-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O6S2.Na/c6-5(13(9,10)11)2-1-3-12(7,8)4-5;/h6H,1-4H2,(H,9,10,11);/q;+1/p-1.
What are the key properties of sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate?
sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate has a molecular weight of 252.24 g/mol, XLogP of -4.57, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-hydroxy-1,1-dioxothiane-3-sulfonate is sourced from PubChem (CID 103574113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).