C14H23IO2 — CID 10360485
(3S,4S,5R)-4-ethyl-3-[(E,3R)-hex-4-en-3-yl]-5-[(1S)-1-iodoethyl]oxolan-2-one (PubChem CID 10360485) has the molecular formula C14H23IO2 and a molecular weight of 350.24 g/mol. Its IUPAC name is (3S,4S,5R)-4-ethyl-3-[(E,3R)-hex-4-en-3-yl]-5-[(1S)-1-iodoethyl]oxolan-2-one.
| Compound Name | (3S,4S,5R)-4-ethyl-3-[(E,3R)-hex-4-en-3-yl]-5-[(1S)-1-iodoethyl]oxolan-2-one |
|---|---|
| PubChem CID | 10360485 |
| Molecular Formula | C14H23IO2 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (3S,4S,5R)-4-ethyl-3-[(E,3R)-hex-4-en-3-yl]-5-[(1S)-1-iodoethyl]oxolan-2-one |
| SMILES | C/C=C/[C@@H](CC)[C@@H]1C(=O)O[C@@H]([C@H](C)I)[C@H]1CC |
| InChI | InChI=1S/C14H23IO2/c1-5-8-10(6-2)12-11(7-3)13(9(4)15)17-14(12)16/h5,8-13H,6-7H2,1-4H3/b8-5+/t9-,10+,11-,12-,13-/m0/s1 |
| InChIKey | RUDXDFSHFHNEGX-RTSBFPPASA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|