C24H20O5 — CID 10362833
methyl (1S,5S,6S,7R)-6-methyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate (PubChem CID 10362833) has the molecular formula C24H20O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is methyl (1S,5S,6S,7R)-6-methyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate.
| Compound Name | methyl (1S,5S,6S,7R)-6-methyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate |
|---|---|
| PubChem CID | 10362833 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl (1S,5S,6S,7R)-6-methyl-2,10-dioxo-8,9-diphenyl-3-oxatricyclo[5.2.1.01,5]dec-8-ene-7-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)[C@@]3(C(=O)OC[C@H]3[C@@H]1C)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C24H20O5/c1-14-17-13-29-22(27)24(17)19(16-11-7-4-8-12-16)18(15-9-5-3-6-10-15)23(14,20(24)25)21(26)28-2/h3-12,14,17H,13H2,1-2H3/t14-,17-,23+,24-/m0/s1 |
| InChIKey | OKKONPBCSCPQKW-XBKSGWBOSA-N |
| XLogP | 3.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|