C20H23N5O5 — CID 10364394
4-N-[(3aR,6R,6aS)-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-nitropyrimidine-4,6-diamine (PubChem CID 10364394) has the molecular formula C20H23N5O5 and a molecular weight of 413.43 g/mol. Its IUPAC name is 4-N-[(3aR,6R,6aS)-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-[(3aR,6R,6aS)-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 10364394 |
| Molecular Formula | C20H23N5O5 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 4-N-[(3aR,6R,6aS)-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-5-nitropyrimidine-4,6-diamine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(COCc1ccccc1)=C[C@H]2Nc1ncnc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23N5O5/c1-20(2)29-16-13(10-28-9-12-6-4-3-5-7-12)8-14(17(16)30-20)24-19-15(25(26)27)18(21)22-11-23-19/h3-8,11,14,16-17H,9-10H2,1-2H3,(H3,21,22,23,24)/t14-,16-,17+/m1/s1 |
| InChIKey | FCNXKLNVTQQUKJ-OIISXLGYSA-N |
| XLogP | 2.42 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|