C27H44O2SSi2 — CID 10368246
tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfanyl-2-phenylethoxy]-dimethylsilane (PubChem CID 10368246) has the molecular formula C27H44O2SSi2 and a molecular weight of 488.89 g/mol. Its IUPAC name is tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfanyl-2-phenylethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfanyl-2-phenylethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10368246 |
| Molecular Formula | C27H44O2SSi2 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | tert-butyl-[(1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfanyl-2-phenylethoxy]-dimethylsilane |
| SMILES | Cc1ccc(S[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H44O2SSi2/c1-21-17-19-23(20-18-21)30-25(29-32(10,11)27(5,6)7)24(22-15-13-12-14-16-22)28-31(8,9)26(2,3)4/h12-20,24-25H,1-11H3/t24-,25-/m0/s1 |
| InChIKey | IUXDHRRDXYXQIW-DQEYMECFSA-N |
| XLogP | 9.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|