About 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide
2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide (PubChem CID 103725511) has the molecular formula C12H21N3O4
and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide |
| PubChem CID | 103725511 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide |
| SMILES | CCCC(CCO)CNC(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C12H21N3O4/c1-2-3-9(4-5-16)6-13-10(17)8-15-11(18)7-14-12(15)19/h9,16H,2-8H2,1H3,(H,13,17)(H,14,19) |
| InChIKey | CNYXJGUUYNGLPE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide?
The IUPAC name of 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide (CID 103725511) is 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide.
What is the SMILES notation for 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide?
The canonical SMILES for 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide is CCCC(CCO)CNC(=O)CN1C(=O)CNC1=O.
What is the InChIKey of 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide?
The InChIKey is CNYXJGUUYNGLPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O4/c1-2-3-9(4-5-16)6-13-10(17)8-15-11(18)7-14-12(15)19/h9,16H,2-8H2,1H3,(H,13,17)(H,14,19).
What are the key properties of 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide?
2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide has a molecular weight of 271.32 g/mol, XLogP of -0.55, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxoimidazolidin-1-yl)-N-[2-(2-hydroxyethyl)pentyl]acetamide is sourced from PubChem (CID 103725511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).