C13H13N3O2S2 — CID 103727451
5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone (PubChem CID 103727451) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone.
| Compound Name | 5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103727451 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraen-4-yl-(3-hydroxy-3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1(O)CCN(C(=O)c2cc3c(nc4sccn43)s2)C1 |
| InChI | InChI=1S/C13H13N3O2S2/c1-13(18)2-3-15(7-13)11(17)9-6-8-10(20-9)14-12-16(8)4-5-19-12/h4-6,18H,2-3,7H2,1H3 |
| InChIKey | YCLNVVGYDQXHRY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |