C11H16N6O3 — CID 103741600
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide (PubChem CID 103741600) has the molecular formula C11H16N6O3 and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 103741600 |
| Molecular Formula | C11H16N6O3 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN1C(=O)NC(C)(C)C1=O)c1ncn[nH]1 |
| InChI | InChI=1S/C11H16N6O3/c1-6(8-12-5-13-16-8)14-7(18)4-17-9(19)11(2,3)15-10(17)20/h5-6H,4H2,1-3H3,(H,14,18)(H,15,20)(H,12,13,16) |
| InChIKey | UOCDQHOGNIBKTK-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|