About ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate
ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate (PubChem CID 103742732) has the molecular formula C15H22N2O3
and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate |
| PubChem CID | 103742732 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC2CC(OC)C2(C)C)nc1 |
| InChI | InChI=1S/C15H22N2O3/c1-5-20-14(18)10-6-7-13(16-9-10)17-11-8-12(19-4)15(11,2)3/h6-7,9,11-12H,5,8H2,1-4H3,(H,16,17) |
| InChIKey | NGQINCOQUZPQQE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate?
The IUPAC name of ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate (CID 103742732) is ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate?
The canonical SMILES for ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate is CCOC(=O)c1ccc(NC2CC(OC)C2(C)C)nc1.
What is the InChIKey of ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate?
The InChIKey is NGQINCOQUZPQQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-5-20-14(18)10-6-7-13(16-9-10)17-11-8-12(19-4)15(11,2)3/h6-7,9,11-12H,5,8H2,1-4H3,(H,16,17).
What are the key properties of ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate?
ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate has a molecular weight of 278.35 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[(3-methoxy-2,2-dimethylcyclobutyl)amino]pyridine-3-carboxylate is sourced from PubChem (CID 103742732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).