C15H24O4 — CID 10378348
ethyl 2-[(1R,3aR,6aR)-3a-hydroxy-5,5,6a-trimethyl-2-oxo-1,3,4,6-tetrahydropentalen-1-yl]acetate (PubChem CID 10378348) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is ethyl 2-[(1R,3aR,6aR)-3a-hydroxy-5,5,6a-trimethyl-2-oxo-1,3,4,6-tetrahydropentalen-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,3aR,6aR)-3a-hydroxy-5,5,6a-trimethyl-2-oxo-1,3,4,6-tetrahydropentalen-1-yl]acetate |
|---|---|
| PubChem CID | 10378348 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | ethyl 2-[(1R,3aR,6aR)-3a-hydroxy-5,5,6a-trimethyl-2-oxo-1,3,4,6-tetrahydropentalen-1-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C(=O)C[C@]2(O)CC(C)(C)C[C@]12C |
| InChI | InChI=1S/C15H24O4/c1-5-19-12(17)6-10-11(16)7-15(18)9-13(2,3)8-14(10,15)4/h10,18H,5-9H2,1-4H3/t10-,14+,15-/m0/s1 |
| InChIKey | MFLFFRPGVFSFKG-VQISRLSMSA-N |
| XLogP | 2.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |