C17H28OS2 — CID 10380831
(2E,4E)-5-[2-[(Z)-oct-2-enyl]-1,3-dithian-2-yl]penta-2,4-dien-1-ol (PubChem CID 10380831) has the molecular formula C17H28OS2 and a molecular weight of 312.54 g/mol. Its IUPAC name is (2E,4E)-5-[2-[(Z)-oct-2-enyl]-1,3-dithian-2-yl]penta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-[2-[(Z)-oct-2-enyl]-1,3-dithian-2-yl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 10380831 |
| Molecular Formula | C17H28OS2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (2E,4E)-5-[2-[(Z)-oct-2-enyl]-1,3-dithian-2-yl]penta-2,4-dien-1-ol |
| SMILES | CCCCC/C=C\CC1(/C=C/C=C/CO)SCCCS1 |
| InChI | InChI=1S/C17H28OS2/c1-2-3-4-5-6-8-12-17(13-9-7-10-14-18)19-15-11-16-20-17/h6-10,13,18H,2-5,11-12,14-16H2,1H3/b8-6-,10-7+,13-9+ |
| InChIKey | HEERVKRFIRCJEU-BZCOAOFGSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|