C9H16OS2 — CID 53305525
(Z,4R)-4-(1,3-dithian-2-yl)pent-2-en-1-ol (PubChem CID 53305525) has the molecular formula C9H16OS2 and a molecular weight of 204.36 g/mol. Its IUPAC name is (Z,4R)-4-(1,3-dithian-2-yl)pent-2-en-1-ol.
| Compound Name | (Z,4R)-4-(1,3-dithian-2-yl)pent-2-en-1-ol |
|---|---|
| PubChem CID | 53305525 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (Z,4R)-4-(1,3-dithian-2-yl)pent-2-en-1-ol |
| SMILES | C[C@H](/C=C\CO)C1SCCCS1 |
| InChI | InChI=1S/C9H16OS2/c1-8(4-2-5-10)9-11-6-3-7-12-9/h2,4,8-10H,3,5-7H2,1H3/b4-2-/t8-/m1/s1 |
| InChIKey | GAEFSFHEDABDBO-DLRBJTRDSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|