C22H25NO4 — CID 10384337
(4-ethoxycarbonylphenyl) 1,4,4-trimethyl-2,3-dihydroquinoline-6-carboxylate (PubChem CID 10384337) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl) 1,4,4-trimethyl-2,3-dihydroquinoline-6-carboxylate.
| Compound Name | (4-ethoxycarbonylphenyl) 1,4,4-trimethyl-2,3-dihydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 10384337 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (4-ethoxycarbonylphenyl) 1,4,4-trimethyl-2,3-dihydroquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)c2ccc3c(c2)C(C)(C)CCN3C)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-5-26-20(24)15-6-9-17(10-7-15)27-21(25)16-8-11-19-18(14-16)22(2,3)12-13-23(19)4/h6-11,14H,5,12-13H2,1-4H3 |
| InChIKey | UGHNUUSNQRGYRQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|